C15H15ClN2O4S — CID 3055090
3-amino-4-[2-(4-chlorophenyl)ethyl]-5-sulfamoylbenzoic acid (PubChem CID 3055090) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is 3-amino-4-[2-(4-chlorophenyl)ethyl]-5-sulfamoylbenzoic acid.
| Compound Name | 3-amino-4-[2-(4-chlorophenyl)ethyl]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 3055090 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-amino-4-[2-(4-chlorophenyl)ethyl]-5-sulfamoylbenzoic acid |
| SMILES | Nc1cc(C(=O)O)cc(S(N)(=O)=O)c1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClN2O4S/c16-11-4-1-9(2-5-11)3-6-12-13(17)7-10(15(19)20)8-14(12)23(18,21)22/h1-2,4-5,7-8H,3,6,17H2,(H,19,20)(H2,18,21,22) |
| InChIKey | AUTABXMLRAFZRR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|