C30H22O8 — CID 71093182
5-[4-[2-[4-(3,5-dicarboxyphenyl)phenyl]ethyl]phenyl]benzene-1,3-dicarboxylic acid (PubChem CID 71093182) has the molecular formula C30H22O8 and a molecular weight of 510.50 g/mol. Its IUPAC name is 5-[4-[2-[4-(3,5-dicarboxyphenyl)phenyl]ethyl]phenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[4-[2-[4-(3,5-dicarboxyphenyl)phenyl]ethyl]phenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 71093182 |
| Molecular Formula | C30H22O8 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 5-[4-[2-[4-(3,5-dicarboxyphenyl)phenyl]ethyl]phenyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2ccc(CCc3ccc(-c4cc(C(=O)O)cc(C(=O)O)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C30H22O8/c31-27(32)23-11-21(12-24(15-23)28(33)34)19-7-3-17(4-8-19)1-2-18-5-9-20(10-6-18)22-13-25(29(35)36)16-26(14-22)30(37)38/h3-16H,1-2H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | QXIYHTFLXDMPLA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |