C30H18O8 — CID 102105468
5-[6-(3,5-dicarboxyphenyl)anthracen-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 102105468) has the molecular formula C30H18O8 and a molecular weight of 506.47 g/mol. Its IUPAC name is 5-[6-(3,5-dicarboxyphenyl)anthracen-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[6-(3,5-dicarboxyphenyl)anthracen-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 102105468 |
| Molecular Formula | C30H18O8 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-[6-(3,5-dicarboxyphenyl)anthracen-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2ccc3cc4cc(-c5cc(C(=O)O)cc(C(=O)O)c5)ccc4cc3c2)c1 |
| InChI | InChI=1S/C30H18O8/c31-27(32)23-9-21(10-24(13-23)28(33)34)17-3-1-15-5-20-8-18(4-2-16(20)6-19(15)7-17)22-11-25(29(35)36)14-26(12-22)30(37)38/h1-14H,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | JZTROIVBMQRJPY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|