C22H15NO8 — CID 132581806
5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (PubChem CID 132581806) has the molecular formula C22H15NO8 and a molecular weight of 421.36 g/mol. Its IUPAC name is 5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 132581806 |
| Molecular Formula | C22H15NO8 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| SMILES | Nc1cc(-c2cc(C(=O)O)cc(C(=O)O)c2)ccc1-c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C22H15NO8/c23-18-9-10(11-3-13(19(24)25)7-14(4-11)20(26)27)1-2-17(18)12-5-15(21(28)29)8-16(6-12)22(30)31/h1-9H,23H2,(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | PUZBJBMUFJIHTL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|