C44H28N2O16 — CID 132838127
5-[2-amino-5-[4-amino-3,5-bis(3,5-dicarboxyphenyl)phenyl]-3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (PubChem CID 132838127) has the molecular formula C44H28N2O16 and a molecular weight of 840.71 g/mol. Its IUPAC name is 5-[2-amino-5-[4-amino-3,5-bis(3,5-dicarboxyphenyl)phenyl]-3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-amino-5-[4-amino-3,5-bis(3,5-dicarboxyphenyl)phenyl]-3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 132838127 |
| Molecular Formula | C44H28N2O16 |
| Molecular Weight | 840.71 g/mol |
| Exact Mass | 840.14 |
| IUPAC Name | 5-[2-amino-5-[4-amino-3,5-bis(3,5-dicarboxyphenyl)phenyl]-3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| SMILES | Nc1c(-c2cc(C(=O)O)cc(C(=O)O)c2)cc(-c2cc(-c3cc(C(=O)O)cc(C(=O)O)c3)c(N)c(-c3cc(C(=O)O)cc(C(=O)O)c3)c2)cc1-c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C44H28N2O16/c45-35-31(19-1-23(37(47)48)9-24(2-19)38(49)50)13-17(14-32(35)20-3-25(39(51)52)10-26(4-20)40(53)54)18-15-33(21-5-27(41(55)56)11-28(6-21)42(57)58)36(46)34(16-18)22-7-29(43(59)60)12-30(8-22)44(61)62/h1-16H,45-46H2,(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62) |
| InChIKey | RVAKMLRHVWNDGR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 350.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|