C23H17NO8 — CID 170899747
5-[5-amino-3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid (PubChem CID 170899747) has the molecular formula C23H17NO8 and a molecular weight of 435.39 g/mol. Its IUPAC name is 5-[5-amino-3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-amino-3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 170899747 |
| Molecular Formula | C23H17NO8 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-[5-amino-3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(-c2cc(C(=O)O)cc(C(=O)O)c2)cc(N)cc1-c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C23H17NO8/c1-10-18(11-2-13(20(25)26)6-14(3-11)21(27)28)8-17(24)9-19(10)12-4-15(22(29)30)7-16(5-12)23(31)32/h2-9H,24H2,1H3,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | PHBIAXHFMYPXLS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|