C27H23NO2 — CID 144851372
4-[2-amino-3,5-bis(4-methylphenyl)phenyl]benzoic acid (PubChem CID 144851372) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-[2-amino-3,5-bis(4-methylphenyl)phenyl]benzoic acid.
| Compound Name | 4-[2-amino-3,5-bis(4-methylphenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 144851372 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-[2-amino-3,5-bis(4-methylphenyl)phenyl]benzoic acid |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)c(N)c(-c3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C27H23NO2/c1-17-3-7-19(8-4-17)23-15-24(20-9-5-18(2)6-10-20)26(28)25(16-23)21-11-13-22(14-12-21)27(29)30/h3-16H,28H2,1-2H3,(H,29,30) |
| InChIKey | QKQNVCSZVNAPRH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|