C14H10N2O6 — CID 53229622
5-(6-amino-2-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid (PubChem CID 53229622) has the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. Its IUPAC name is 5-(6-amino-2-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(6-amino-2-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 53229622 |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-(6-amino-2-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid |
| SMILES | Nc1ccc(-c2cc(C(=O)O)cc(C(=O)O)c2)c(C(=O)O)n1 |
| InChI | InChI=1S/C14H10N2O6/c15-10-2-1-9(11(16-10)14(21)22)6-3-7(12(17)18)5-8(4-6)13(19)20/h1-5H,(H2,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | OVTCRNOVPDLUSH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |