C15H12N2O5 — CID 137660166
4-(3-Acetamidophenyl)pyridine-2,6-dicarboxylic acid (PubChem CID 137660166) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 4-(3-acetamidophenyl)pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-(3-Acetamidophenyl)pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 137660166 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-(3-acetamidophenyl)pyridine-2,6-dicarboxylic acid |
| SMILES | CC(=O)NC1=CC=CC(=C1)C2=CC(=NC(=C2)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H12N2O5/c1-8(18)16-11-4-2-3-9(5-11)10-6-12(14(19)20)17-13(7-10)15(21)22/h2-7H,1H3,(H,16,18)(H,19,20)(H,21,22) |
| InChIKey | DNRKHSWQNBHGKQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 431 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |