4-phenylpyridine-2,6-dicarboxylic acid

C13H9NO4 — CID 12843432

IUPAC4-phenylpyridine-2,6-dicarboxylic acid
SMILESO=C(O)c1cc(-c2ccccc2)cc(C(=O)O)n1
InChIInChI=1S/C13H9NO4/c15-12(16)10-6-9(7-11(14-10)13(17)18)8-4-2-1-3-5-8/h1-7H,(H,15,16)(H,17,18)
InChIKeyVHENPTPXTMAFOQ-UHFFFAOYSA-N
MW243.22 g/mol
LogP2.14
Rot. Bonds3

About 4-phenylpyridine-2,6-dicarboxylic acid

4-phenylpyridine-2,6-dicarboxylic acid (PubChem CID 12843432) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-phenylpyridine-2,6-dicarboxylic acid.

Molecular Properties

Compound Name4-phenylpyridine-2,6-dicarboxylic acid
PubChem CID12843432
Molecular FormulaC13H9NO4
Molecular Weight243.22 g/mol
Exact Mass243.05
IUPAC Name4-phenylpyridine-2,6-dicarboxylic acid
SMILESO=C(O)c1cc(-c2ccccc2)cc(C(=O)O)n1
InChIInChI=1S/C13H9NO4/c15-12(16)10-6-9(7-11(14-10)13(17)18)8-4-2-1-3-5-8/h1-7H,(H,15,16)(H,17,18)
InChIKeyVHENPTPXTMAFOQ-UHFFFAOYSA-N
XLogP2.14
TPSA87.49 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.22
LogP ≤ 52.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-phenylpyridine-2,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-phenylpyridine-2,6-dicarboxylic acid?
The IUPAC name of 4-phenylpyridine-2,6-dicarboxylic acid (CID 12843432) is 4-phenylpyridine-2,6-dicarboxylic acid.
What is the SMILES notation for 4-phenylpyridine-2,6-dicarboxylic acid?
The canonical SMILES for 4-phenylpyridine-2,6-dicarboxylic acid is O=C(O)c1cc(-c2ccccc2)cc(C(=O)O)n1.
What is the InChIKey of 4-phenylpyridine-2,6-dicarboxylic acid?
The InChIKey is VHENPTPXTMAFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO4/c15-12(16)10-6-9(7-11(14-10)13(17)18)8-4-2-1-3-5-8/h1-7H,(H,15,16)(H,17,18).
What are the key properties of 4-phenylpyridine-2,6-dicarboxylic acid?
4-phenylpyridine-2,6-dicarboxylic acid has a molecular weight of 243.22 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpyridine-2,6-dicarboxylic acid is sourced from PubChem (CID 12843432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).