C14H9FO5 — CID 53219708
5-(2-fluoro-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid (PubChem CID 53219708) has the molecular formula C14H9FO5 and a molecular weight of 276.22 g/mol. Its IUPAC name is 5-(2-fluoro-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(2-fluoro-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 53219708 |
| Molecular Formula | C14H9FO5 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 5-(2-fluoro-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2ccc(O)cc2F)c1 |
| InChI | InChI=1S/C14H9FO5/c15-12-6-10(16)1-2-11(12)7-3-8(13(17)18)5-9(4-7)14(19)20/h1-6,16H,(H,17,18)(H,19,20) |
| InChIKey | AHVMFKGBQFZZID-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |