C15H13FO5 — CID 82107186
5-(2-fluoro-4-hydroxyphenyl)-2,3-dimethoxybenzoic acid (PubChem CID 82107186) has the molecular formula C15H13FO5 and a molecular weight of 292.26 g/mol. Its IUPAC name is 5-(2-fluoro-4-hydroxyphenyl)-2,3-dimethoxybenzoic acid.
| Compound Name | 5-(2-fluoro-4-hydroxyphenyl)-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 82107186 |
| Molecular Formula | C15H13FO5 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-(2-fluoro-4-hydroxyphenyl)-2,3-dimethoxybenzoic acid |
| SMILES | COc1cc(-c2ccc(O)cc2F)cc(C(=O)O)c1OC |
| InChI | InChI=1S/C15H13FO5/c1-20-13-6-8(5-11(15(18)19)14(13)21-2)10-4-3-9(17)7-12(10)16/h3-7,17H,1-2H3,(H,18,19) |
| InChIKey | YPQUOPRYYORRQI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |