C16H14F2O4 — CID 69110325
5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid (PubChem CID 69110325) has the molecular formula C16H14F2O4 and a molecular weight of 308.28 g/mol. Its IUPAC name is 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid.
| Compound Name | 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 69110325 |
| Molecular Formula | C16H14F2O4 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid |
| SMILES | COc1cc(-c2cc(C)c(OC)c(C(=O)O)c2)cc(F)c1F |
| InChI | InChI=1S/C16H14F2O4/c1-8-4-9(5-11(16(19)20)15(8)22-3)10-6-12(17)14(18)13(7-10)21-2/h4-7H,1-3H3,(H,19,20) |
| InChIKey | RFEKIIGYJZARQX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |