5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid

C16H14F2O4 — CID 69110325

IUPAC5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid
SMILESCOc1cc(-c2cc(C)c(OC)c(C(=O)O)c2)cc(F)c1F
InChIInChI=1S/C16H14F2O4/c1-8-4-9(5-11(16(19)20)15(8)22-3)10-6-12(17)14(18)13(7-10)21-2/h4-7H,1-3H3,(H,19,20)
InChIKeyRFEKIIGYJZARQX-UHFFFAOYSA-N
MW308.28 g/mol
LogP3.66
Rot. Bonds4

About 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid

5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid (PubChem CID 69110325) has the molecular formula C16H14F2O4 and a molecular weight of 308.28 g/mol. Its IUPAC name is 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid.

Molecular Properties

Compound Name5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid
PubChem CID69110325
Molecular FormulaC16H14F2O4
Molecular Weight308.28 g/mol
Exact Mass308.09
IUPAC Name5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid
SMILESCOc1cc(-c2cc(C)c(OC)c(C(=O)O)c2)cc(F)c1F
InChIInChI=1S/C16H14F2O4/c1-8-4-9(5-11(16(19)20)15(8)22-3)10-6-12(17)14(18)13(7-10)21-2/h4-7H,1-3H3,(H,19,20)
InChIKeyRFEKIIGYJZARQX-UHFFFAOYSA-N
XLogP3.66
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.28
LogP ≤ 53.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid?
The IUPAC name of 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid (CID 69110325) is 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid.
What is the SMILES notation for 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid?
The canonical SMILES for 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid is COc1cc(-c2cc(C)c(OC)c(C(=O)O)c2)cc(F)c1F.
What is the InChIKey of 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid?
The InChIKey is RFEKIIGYJZARQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2O4/c1-8-4-9(5-11(16(19)20)15(8)22-3)10-6-12(17)14(18)13(7-10)21-2/h4-7H,1-3H3,(H,19,20).
What are the key properties of 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid?
5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid has a molecular weight of 308.28 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-difluoro-5-methoxyphenyl)-2-methoxy-3-methylbenzoic acid is sourced from PubChem (CID 69110325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).