2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid

C19H17NO5 — CID 82039992

IUPAC2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid
SMILESCOc1cc(-c2ccc(OC)c3ncccc23)cc(C(=O)O)c1OC
InChIInChI=1S/C19H17NO5/c1-23-15-7-6-12(13-5-4-8-20-17(13)15)11-9-14(19(21)22)18(25-3)16(10-11)24-2/h4-10H,1-3H3,(H,21,22)
InChIKeyGITGXSUDOXAAAQ-UHFFFAOYSA-N
MW339.35 g/mol
LogP3.63
Rot. Bonds5

About 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid

2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid (PubChem CID 82039992) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid.

Molecular Properties

Compound Name2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid
PubChem CID82039992
Molecular FormulaC19H17NO5
Molecular Weight339.35 g/mol
Exact Mass339.11
IUPAC Name2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid
SMILESCOc1cc(-c2ccc(OC)c3ncccc23)cc(C(=O)O)c1OC
InChIInChI=1S/C19H17NO5/c1-23-15-7-6-12(13-5-4-8-20-17(13)15)11-9-14(19(21)22)18(25-3)16(10-11)24-2/h4-10H,1-3H3,(H,21,22)
InChIKeyGITGXSUDOXAAAQ-UHFFFAOYSA-N
XLogP3.63
TPSA77.88 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.35
LogP ≤ 53.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid?
The IUPAC name of 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid (CID 82039992) is 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid.
What is the SMILES notation for 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid?
The canonical SMILES for 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid is COc1cc(-c2ccc(OC)c3ncccc23)cc(C(=O)O)c1OC.
What is the InChIKey of 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid?
The InChIKey is GITGXSUDOXAAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-23-15-7-6-12(13-5-4-8-20-17(13)15)11-9-14(19(21)22)18(25-3)16(10-11)24-2/h4-10H,1-3H3,(H,21,22).
What are the key properties of 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid?
2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid has a molecular weight of 339.35 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzoic acid is sourced from PubChem (CID 82039992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).