C19H16N2O3 — CID 39231570
3,4-dimethoxy-5-(8-methoxyquinolin-5-yl)benzonitrile (PubChem CID 39231570) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(8-methoxyquinolin-5-yl)benzonitrile.
| Compound Name | 3,4-dimethoxy-5-(8-methoxyquinolin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 39231570 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3,4-dimethoxy-5-(8-methoxyquinolin-5-yl)benzonitrile |
| SMILES | COc1cc(C#N)cc(-c2ccc(OC)c3ncccc23)c1OC |
| InChI | InChI=1S/C19H16N2O3/c1-22-16-7-6-13(14-5-4-8-21-18(14)16)15-9-12(11-20)10-17(23-2)19(15)24-3/h4-10H,1-3H3 |
| InChIKey | XHSHLYOKMLZCSP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |