C17H14N2O2 — CID 39231418
3-(1H-indol-5-yl)-4,5-dimethoxybenzonitrile (PubChem CID 39231418) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(1H-indol-5-yl)-4,5-dimethoxybenzonitrile.
| Compound Name | 3-(1H-indol-5-yl)-4,5-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 39231418 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(1H-indol-5-yl)-4,5-dimethoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(-c2ccc3[nH]ccc3c2)c1OC |
| InChI | InChI=1S/C17H14N2O2/c1-20-16-8-11(10-18)7-14(17(16)21-2)12-3-4-15-13(9-12)5-6-19-15/h3-9,19H,1-2H3 |
| InChIKey | PZZVEFUHXGNZRU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |