C24H20N2O3S — CID 69054288
4-(1H-indol-5-yl)-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridine (PubChem CID 69054288) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-(1H-indol-5-yl)-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridine.
| Compound Name | 4-(1H-indol-5-yl)-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 69054288 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-(1H-indol-5-yl)-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridine |
| SMILES | COc1cc(-c2cnc(-c3ccc4[nH]ccc4c3)c3ccsc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H20N2O3S/c1-27-20-11-16(12-21(28-2)23(20)29-3)18-13-26-22(17-7-9-30-24(17)18)15-4-5-19-14(10-15)6-8-25-19/h4-13,25H,1-3H3 |
| InChIKey | JTHQRZPBTPPQAD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |