About 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole
5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole (PubChem CID 66726497) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole.
Molecular Properties
| Compound Name | 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole |
| PubChem CID | 66726497 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole |
| SMILES | COc1cc(CCc2ccc3[nH]ccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21NO3/c1-21-17-11-14(12-18(22-2)19(17)23-3)5-4-13-6-7-16-15(10-13)8-9-20-16/h6-12,20H,4-5H2,1-3H3 |
| InChIKey | GRKFGZJFNQFINM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole?
The IUPAC name of 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole (CID 66726497) is 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole.
What is the SMILES notation for 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole?
The canonical SMILES for 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole is COc1cc(CCc2ccc3[nH]ccc3c2)cc(OC)c1OC.
What is the InChIKey of 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole?
The InChIKey is GRKFGZJFNQFINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-21-17-11-14(12-18(22-2)19(17)23-3)5-4-13-6-7-16-15(10-13)8-9-20-16/h6-12,20H,4-5H2,1-3H3.
What are the key properties of 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole?
5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole has a molecular weight of 311.38 g/mol, XLogP of 3.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole is sourced from PubChem (CID 66726497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).