C22H24N2O4 — CID 39313525
N-cyclopropyl-N-(1H-indol-5-ylmethyl)-3,4,5-trimethoxybenzamide (PubChem CID 39313525) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-cyclopropyl-N-(1H-indol-5-ylmethyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-cyclopropyl-N-(1H-indol-5-ylmethyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 39313525 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-cyclopropyl-N-(1H-indol-5-ylmethyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N(Cc2ccc3[nH]ccc3c2)C2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N2O4/c1-26-19-11-16(12-20(27-2)21(19)28-3)22(25)24(17-5-6-17)13-14-4-7-18-15(10-14)8-9-23-18/h4,7-12,17,23H,5-6,13H2,1-3H3 |
| InChIKey | JWWCMHMXRRBOJH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |