C12H11N3O2 — CID 117330207
4-(4-methoxy-1H-indol-6-yl)-1,2-oxazol-5-amine (PubChem CID 117330207) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-(4-methoxy-1H-indol-6-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(4-methoxy-1H-indol-6-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117330207 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-(4-methoxy-1H-indol-6-yl)-1,2-oxazol-5-amine |
| SMILES | COc1cc(-c2cnoc2N)cc2[nH]ccc12 |
| InChI | InChI=1S/C12H11N3O2/c1-16-11-5-7(9-6-15-17-12(9)13)4-10-8(11)2-3-14-10/h2-6,14H,13H2,1H3 |
| InChIKey | NYUAKUZMDXVZDO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |