C15H18N2O3S — CID 117491641
4-[4-methoxy-3-(thian-4-yloxy)phenyl]-1,2-oxazol-5-amine (PubChem CID 117491641) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[4-methoxy-3-(thian-4-yloxy)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[4-methoxy-3-(thian-4-yloxy)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117491641 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[4-methoxy-3-(thian-4-yloxy)phenyl]-1,2-oxazol-5-amine |
| SMILES | COc1ccc(-c2cnoc2N)cc1OC1CCSCC1 |
| InChI | InChI=1S/C15H18N2O3S/c1-18-13-3-2-10(12-9-17-20-15(12)16)8-14(13)19-11-4-6-21-7-5-11/h2-3,8-9,11H,4-7,16H2,1H3 |
| InChIKey | LLZIGBFTJZXMCJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |