C14H16N2O3S — CID 117472099
5-[3-methoxy-4-(thiolan-3-yloxy)phenyl]-1,2-oxazol-3-amine (PubChem CID 117472099) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-[3-methoxy-4-(thiolan-3-yloxy)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[3-methoxy-4-(thiolan-3-yloxy)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117472099 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-[3-methoxy-4-(thiolan-3-yloxy)phenyl]-1,2-oxazol-3-amine |
| SMILES | COc1cc(-c2cc(N)no2)ccc1OC1CCSC1 |
| InChI | InChI=1S/C14H16N2O3S/c1-17-13-6-9(12-7-14(15)16-19-12)2-3-11(13)18-10-4-5-20-8-10/h2-3,6-7,10H,4-5,8H2,1H3,(H2,15,16) |
| InChIKey | DNJYPAPETQBOSO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |