C12H17NO3S — CID 117391644
O-[[3-methoxy-4-(thiolan-3-yloxy)phenyl]methyl]hydroxylamine (PubChem CID 117391644) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is O-[[3-methoxy-4-(thiolan-3-yloxy)phenyl]methyl]hydroxylamine.
| Compound Name | O-[[3-methoxy-4-(thiolan-3-yloxy)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117391644 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | O-[[3-methoxy-4-(thiolan-3-yloxy)phenyl]methyl]hydroxylamine |
| SMILES | COc1cc(CON)ccc1OC1CCSC1 |
| InChI | InChI=1S/C12H17NO3S/c1-14-12-6-9(7-15-13)2-3-11(12)16-10-4-5-17-8-10/h2-3,6,10H,4-5,7-8,13H2,1H3 |
| InChIKey | KFJRWPRALUPYRP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|