C13H18O3S — CID 117389372
[3-methoxy-4-(thian-4-yloxy)phenyl]methanol (PubChem CID 117389372) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is [3-methoxy-4-(thian-4-yloxy)phenyl]methanol.
| Compound Name | [3-methoxy-4-(thian-4-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 117389372 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | [3-methoxy-4-(thian-4-yloxy)phenyl]methanol |
| SMILES | COc1cc(CO)ccc1OC1CCSCC1 |
| InChI | InChI=1S/C13H18O3S/c1-15-13-8-10(9-14)2-3-12(13)16-11-4-6-17-7-5-11/h2-3,8,11,14H,4-7,9H2,1H3 |
| InChIKey | DLXUAUGCZMCSLP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |