C13H19NO2S — CID 115005336
[4-methoxy-3-(thian-4-yloxy)phenyl]methanamine (PubChem CID 115005336) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is [4-methoxy-3-(thian-4-yloxy)phenyl]methanamine.
| Compound Name | [4-methoxy-3-(thian-4-yloxy)phenyl]methanamine |
|---|---|
| PubChem CID | 115005336 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [4-methoxy-3-(thian-4-yloxy)phenyl]methanamine |
| SMILES | COc1ccc(CN)cc1OC1CCSCC1 |
| InChI | InChI=1S/C13H19NO2S/c1-15-12-3-2-10(9-14)8-13(12)16-11-4-6-17-7-5-11/h2-3,8,11H,4-7,9,14H2,1H3 |
| InChIKey | MBYRSDBWXKPXPJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |