C15H22O3S — CID 117454015
2-[3-methoxy-4-(thian-4-yloxy)phenyl]propan-1-ol (PubChem CID 117454015) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-[3-methoxy-4-(thian-4-yloxy)phenyl]propan-1-ol.
| Compound Name | 2-[3-methoxy-4-(thian-4-yloxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117454015 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[3-methoxy-4-(thian-4-yloxy)phenyl]propan-1-ol |
| SMILES | COc1cc(C(C)CO)ccc1OC1CCSCC1 |
| InChI | InChI=1S/C15H22O3S/c1-11(10-16)12-3-4-14(15(9-12)17-2)18-13-5-7-19-8-6-13/h3-4,9,11,13,16H,5-8,10H2,1-2H3 |
| InChIKey | XPYMACWIEMYNIY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |