C15H20O3S — CID 117450418
3-[3-methoxy-4-(thian-3-yloxy)phenyl]propanal (PubChem CID 117450418) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-[3-methoxy-4-(thian-3-yloxy)phenyl]propanal.
| Compound Name | 3-[3-methoxy-4-(thian-3-yloxy)phenyl]propanal |
|---|---|
| PubChem CID | 117450418 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[3-methoxy-4-(thian-3-yloxy)phenyl]propanal |
| SMILES | COc1cc(CCC=O)ccc1OC1CCCSC1 |
| InChI | InChI=1S/C15H20O3S/c1-17-15-10-12(4-2-8-16)6-7-14(15)18-13-5-3-9-19-11-13/h6-8,10,13H,2-5,9,11H2,1H3 |
| InChIKey | IVLJDINDRWNXKS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|