C13H14ClN3O2 — CID 117448772
5-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]-1,2-oxazol-3-amine (PubChem CID 117448772) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 5-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117448772 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]-1,2-oxazol-3-amine |
| SMILES | CN1CC(Oc2ccc(-c3cc(N)no3)cc2Cl)C1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-17-6-9(7-17)18-11-3-2-8(4-10(11)14)12-5-13(15)16-19-12/h2-5,9H,6-7H2,1H3,(H2,15,16) |
| InChIKey | AQRJUGLFVMIHCS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |