C14H15ClN2O3 — CID 117475309
5-[3-chloro-4-(oxan-3-yloxy)phenyl]-1,2-oxazol-3-amine (PubChem CID 117475309) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 5-[3-chloro-4-(oxan-3-yloxy)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[3-chloro-4-(oxan-3-yloxy)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117475309 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-[3-chloro-4-(oxan-3-yloxy)phenyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2ccc(OC3CCCOC3)c(Cl)c2)on1 |
| InChI | InChI=1S/C14H15ClN2O3/c15-11-6-9(13-7-14(16)17-20-13)3-4-12(11)19-10-2-1-5-18-8-10/h3-4,6-7,10H,1-2,5,8H2,(H2,16,17) |
| InChIKey | FFCQYHROJHPIPS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |