C14H15ClN2O2 — CID 117447033
5-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazol-3-amine (PubChem CID 117447033) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 5-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117447033 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2ccc(C3CCOCC3)c(Cl)c2)on1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-12-7-10(13-8-14(16)17-19-13)1-2-11(12)9-3-5-18-6-4-9/h1-2,7-9H,3-6H2,(H2,16,17) |
| InChIKey | UJKHAIOKBDMOHL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |