3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid

C15H14ClNO4 — CID 117492610

IUPAC3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(C3CCOCC3)c(Cl)c2)no1
InChIInChI=1S/C15H14ClNO4/c16-12-7-10(13-8-14(15(18)19)21-17-13)1-2-11(12)9-3-5-20-6-4-9/h1-2,7-9H,3-6H2,(H,18,19)
InChIKeyRDZJAIDKRRWXSQ-UHFFFAOYSA-N
MW307.73 g/mol
LogP3.59
Rot. Bonds3

About 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid

3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117492610) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid
PubChem CID117492610
Molecular FormulaC15H14ClNO4
Molecular Weight307.73 g/mol
Exact Mass307.06
IUPAC Name3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(C3CCOCC3)c(Cl)c2)no1
InChIInChI=1S/C15H14ClNO4/c16-12-7-10(13-8-14(15(18)19)21-17-13)1-2-11(12)9-3-5-20-6-4-9/h1-2,7-9H,3-6H2,(H,18,19)
InChIKeyRDZJAIDKRRWXSQ-UHFFFAOYSA-N
XLogP3.59
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.73
LogP ≤ 53.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid (CID 117492610) is 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(-c2ccc(C3CCOCC3)c(Cl)c2)no1.
What is the InChIKey of 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is RDZJAIDKRRWXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO4/c16-12-7-10(13-8-14(15(18)19)21-17-13)1-2-11(12)9-3-5-20-6-4-9/h1-2,7-9H,3-6H2,(H,18,19).
What are the key properties of 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid?
3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 307.73 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-chloro-4-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117492610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).