C15H15NO4 — CID 117435490
3-[2-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117435490) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[2-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[2-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117435490 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[2-(oxan-4-yl)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2C2CCOCC2)no1 |
| InChI | InChI=1S/C15H15NO4/c17-15(18)14-9-13(16-20-14)12-4-2-1-3-11(12)10-5-7-19-8-6-10/h1-4,9-10H,5-8H2,(H,17,18) |
| InChIKey | GXSMYULURXIAMS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |