C15H15NO4S — CID 117490657
3-[2-(thian-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117490657) has the molecular formula C15H15NO4S and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-[2-(thian-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[2-(thian-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117490657 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-[2-(thian-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2OC2CCCSC2)no1 |
| InChI | InChI=1S/C15H15NO4S/c17-15(18)14-8-12(16-20-14)11-5-1-2-6-13(11)19-10-4-3-7-21-9-10/h1-2,5-6,8,10H,3-4,7,9H2,(H,17,18) |
| InChIKey | CYXMATYZCXYDMQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |