C10H7NO4 — CID 136998648
3-(2-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 136998648) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(2-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136998648 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 3-(2-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2O)no1 |
| InChI | InChI=1S/C10H7NO4/c12-8-4-2-1-3-6(8)7-5-9(10(13)14)15-11-7/h1-5,12H,(H,13,14) |
| InChIKey | XEOXZOWTCSTQHM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |