C10H6ClNO5 — CID 136991054
3-(4-chloro-2,3-dihydroxyphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 136991054) has the molecular formula C10H6ClNO5 and a molecular weight of 255.61 g/mol. Its IUPAC name is 3-(4-chloro-2,3-dihydroxyphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(4-chloro-2,3-dihydroxyphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136991054 |
| Molecular Formula | C10H6ClNO5 |
| Molecular Weight | 255.61 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 3-(4-chloro-2,3-dihydroxyphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)c(O)c2O)no1 |
| InChI | InChI=1S/C10H6ClNO5/c11-5-2-1-4(8(13)9(5)14)6-3-7(10(15)16)17-12-6/h1-3,13-14H,(H,15,16) |
| InChIKey | NONOYMAGJSMGFX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|