3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid

C12H10ClNO3 — CID 117382472

IUPAC3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCc1ccc(Cl)c(-c2cc(C(=O)O)on2)c1C
InChIInChI=1S/C12H10ClNO3/c1-6-3-4-8(13)11(7(6)2)9-5-10(12(15)16)17-14-9/h3-5H,1-2H3,(H,15,16)
InChIKeyUSTODDMRUZHDSX-UHFFFAOYSA-N
MW251.67 g/mol
LogP3.31
Rot. Bonds2

About 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid

3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117382472) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid
PubChem CID117382472
Molecular FormulaC12H10ClNO3
Molecular Weight251.67 g/mol
Exact Mass251.03
IUPAC Name3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCc1ccc(Cl)c(-c2cc(C(=O)O)on2)c1C
InChIInChI=1S/C12H10ClNO3/c1-6-3-4-8(13)11(7(6)2)9-5-10(12(15)16)17-14-9/h3-5H,1-2H3,(H,15,16)
InChIKeyUSTODDMRUZHDSX-UHFFFAOYSA-N
XLogP3.31
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.67
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid (CID 117382472) is 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid is Cc1ccc(Cl)c(-c2cc(C(=O)O)on2)c1C.
What is the InChIKey of 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is USTODDMRUZHDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO3/c1-6-3-4-8(13)11(7(6)2)9-5-10(12(15)16)17-14-9/h3-5H,1-2H3,(H,15,16).
What are the key properties of 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 251.67 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-chloro-2,3-dimethylphenyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117382472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).