3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid

C13H13NO4 — CID 82371528

IUPAC3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)on2)c(C)c1
InChIInChI=1S/C13H13NO4/c1-7-4-9(17-3)5-8(2)12(7)10-6-11(13(15)16)18-14-10/h4-6H,1-3H3,(H,15,16)
InChIKeyGHUYRXKHCZBRTD-UHFFFAOYSA-N
MW247.25 g/mol
LogP2.67
Rot. Bonds3

About 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid

3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 82371528) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid
PubChem CID82371528
Molecular FormulaC13H13NO4
Molecular Weight247.25 g/mol
Exact Mass247.08
IUPAC Name3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)on2)c(C)c1
InChIInChI=1S/C13H13NO4/c1-7-4-9(17-3)5-8(2)12(7)10-6-11(13(15)16)18-14-10/h4-6H,1-3H3,(H,15,16)
InChIKeyGHUYRXKHCZBRTD-UHFFFAOYSA-N
XLogP2.67
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid (CID 82371528) is 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid is COc1cc(C)c(-c2cc(C(=O)O)on2)c(C)c1.
What is the InChIKey of 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is GHUYRXKHCZBRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c1-7-4-9(17-3)5-8(2)12(7)10-6-11(13(15)16)18-14-10/h4-6H,1-3H3,(H,15,16).
What are the key properties of 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid?
3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 247.25 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-2,6-dimethylphenyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 82371528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).