About 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid
3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117411955) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid.
Analyze 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid (CID 117411955) is 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid is COc1ccc(OC)c(-c2cc(C(=O)O)on2)c1C.
What is the InChIKey of 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is MDSVJOLVGFCBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-7-9(17-2)4-5-10(18-3)12(7)8-6-11(13(15)16)19-14-8/h4-6H,1-3H3,(H,15,16).
What are the key properties of 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid?
3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 263.25 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dimethoxy-2-methylphenyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117411955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).