C11H8INO4 — CID 67517083
3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 67517083) has the molecular formula C11H8INO4 and a molecular weight of 345.09 g/mol. Its IUPAC name is 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 67517083 |
| Molecular Formula | C11H8INO4 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)on2)cc1I |
| InChI | InChI=1S/C11H8INO4/c1-16-9-3-2-6(4-7(9)12)8-5-10(11(14)15)17-13-8/h2-5H,1H3,(H,14,15) |
| InChIKey | RCSWBORHGJBLEB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|