C12H10INO4 — CID 67512931
methyl 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylate (PubChem CID 67512931) has the molecular formula C12H10INO4 and a molecular weight of 359.12 g/mol. Its IUPAC name is methyl 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 67512931 |
| Molecular Formula | C12H10INO4 |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | methyl 3-(3-iodo-4-methoxyphenyl)-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(OC)c(I)c2)no1 |
| InChI | InChI=1S/C12H10INO4/c1-16-10-4-3-7(5-8(10)13)9-6-11(18-14-9)12(15)17-2/h3-6H,1-2H3 |
| InChIKey | MCPXKXWKMMWYPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|