C18H22BNO5 — CID 159739301
methyl 3-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazole-5-carboxylate (PubChem CID 159739301) has the molecular formula C18H22BNO5 and a molecular weight of 343.19 g/mol. Its IUPAC name is methyl 3-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 159739301 |
| Molecular Formula | C18H22BNO5 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | methyl 3-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C)c(B3OC(C)(C)C(C)(C)O3)c2)no1 |
| InChI | InChI=1S/C18H22BNO5/c1-11-7-8-12(14-10-15(23-20-14)16(21)22-6)9-13(11)19-24-17(2,3)18(4,5)25-19/h7-10H,1-6H3 |
| InChIKey | NCFXQHOIIPCURM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|