C11H7Cl2NO3 — CID 920393
methyl 3-(2,3-dichlorophenyl)-1,2-oxazole-5-carboxylate (PubChem CID 920393) has the molecular formula C11H7Cl2NO3 and a molecular weight of 272.09 g/mol. Its IUPAC name is methyl 3-(2,3-dichlorophenyl)-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(2,3-dichlorophenyl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 920393 |
| Molecular Formula | C11H7Cl2NO3 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | methyl 3-(2,3-dichlorophenyl)-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(Cl)c2Cl)no1 |
| InChI | InChI=1S/C11H7Cl2NO3/c1-16-11(15)9-5-8(14-17-9)6-3-2-4-7(12)10(6)13/h2-5H,1H3 |
| InChIKey | LHCKQXGYBRDMOF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |