C13H13NO6 — CID 43150115
3-(2,4,5-trimethoxyphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 43150115) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is 3-(2,4,5-trimethoxyphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(2,4,5-trimethoxyphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 43150115 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(2,4,5-trimethoxyphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | COc1cc(OC)c(-c2cc(C(=O)O)on2)cc1OC |
| InChI | InChI=1S/C13H13NO6/c1-17-9-6-11(19-3)10(18-2)4-7(9)8-5-12(13(15)16)20-14-8/h4-6H,1-3H3,(H,15,16) |
| InChIKey | DYYIECDOUAIDHY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |