C15H17NO5 — CID 117470410
3-(2,5-dimethoxy-4-propylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117470410) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-4-propylphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(2,5-dimethoxy-4-propylphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117470410 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-(2,5-dimethoxy-4-propylphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CCCc1cc(OC)c(-c2cc(C(=O)O)on2)cc1OC |
| InChI | InChI=1S/C15H17NO5/c1-4-5-9-6-13(20-3)10(7-12(9)19-2)11-8-14(15(17)18)21-16-11/h6-8H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | PRVSELDNWSOZGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |