3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid

C12H10FNO5 — CID 117421092

IUPAC3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCOc1cc(F)cc(OC)c1-c1cc(C(=O)O)on1
InChIInChI=1S/C12H10FNO5/c1-17-8-3-6(13)4-9(18-2)11(8)7-5-10(12(15)16)19-14-7/h3-5H,1-2H3,(H,15,16)
InChIKeyKYBHNMADLWIYMO-UHFFFAOYSA-N
MW267.21 g/mol
LogP2.20
Rot. Bonds4

About 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid

3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117421092) has the molecular formula C12H10FNO5 and a molecular weight of 267.21 g/mol. Its IUPAC name is 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid
PubChem CID117421092
Molecular FormulaC12H10FNO5
Molecular Weight267.21 g/mol
Exact Mass267.05
IUPAC Name3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCOc1cc(F)cc(OC)c1-c1cc(C(=O)O)on1
InChIInChI=1S/C12H10FNO5/c1-17-8-3-6(13)4-9(18-2)11(8)7-5-10(12(15)16)19-14-7/h3-5H,1-2H3,(H,15,16)
InChIKeyKYBHNMADLWIYMO-UHFFFAOYSA-N
XLogP2.20
TPSA81.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.21
LogP ≤ 52.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid (CID 117421092) is 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid is COc1cc(F)cc(OC)c1-c1cc(C(=O)O)on1.
What is the InChIKey of 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is KYBHNMADLWIYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO5/c1-17-8-3-6(13)4-9(18-2)11(8)7-5-10(12(15)16)19-14-7/h3-5H,1-2H3,(H,15,16).
What are the key properties of 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid?
3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 267.21 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-2,6-dimethoxyphenyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117421092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).