C14H15NO3 — CID 117364843
3-(3,4-diethylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117364843) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(3,4-diethylphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3,4-diethylphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117364843 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-(3,4-diethylphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CCc1ccc(-c2cc(C(=O)O)on2)cc1CC |
| InChI | InChI=1S/C14H15NO3/c1-3-9-5-6-11(7-10(9)4-2)12-8-13(14(16)17)18-15-12/h5-8H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | OVCJSJSIVUPVBY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |