C11H10N2O5S — CID 117453435
3-[2-(methanesulfonamido)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117453435) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is 3-[2-(methanesulfonamido)phenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[2-(methanesulfonamido)phenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117453435 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-[2-(methanesulfonamido)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C11H10N2O5S/c1-19(16,17)13-8-5-3-2-4-7(8)9-6-10(11(14)15)18-12-9/h2-6,13H,1H3,(H,14,15) |
| InChIKey | FCJSXLQIPJTEKV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |