3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid

C12H8N2O4 — CID 117361903

IUPAC3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid
SMILESCc1nc2cccc(-c3cc(C(=O)O)on3)c2o1
InChIInChI=1S/C12H8N2O4/c1-6-13-8-4-2-3-7(11(8)17-6)9-5-10(12(15)16)18-14-9/h2-5H,1H3,(H,15,16)
InChIKeyOHKZRKQXLQBYBU-UHFFFAOYSA-N
MW244.21 g/mol
LogP2.49
Rot. Bonds2

About 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid

3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117361903) has the molecular formula C12H8N2O4 and a molecular weight of 244.21 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid
PubChem CID117361903
Molecular FormulaC12H8N2O4
Molecular Weight244.21 g/mol
Exact Mass244.05
IUPAC Name3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid
SMILESCc1nc2cccc(-c3cc(C(=O)O)on3)c2o1
InChIInChI=1S/C12H8N2O4/c1-6-13-8-4-2-3-7(11(8)17-6)9-5-10(12(15)16)18-14-9/h2-5H,1H3,(H,15,16)
InChIKeyOHKZRKQXLQBYBU-UHFFFAOYSA-N
XLogP2.49
TPSA89.36 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.21
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid (CID 117361903) is 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid is Cc1nc2cccc(-c3cc(C(=O)O)on3)c2o1.
What is the InChIKey of 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is OHKZRKQXLQBYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O4/c1-6-13-8-4-2-3-7(11(8)17-6)9-5-10(12(15)16)18-14-9/h2-5H,1H3,(H,15,16).
What are the key properties of 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid?
3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 244.21 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-benzoxazol-7-yl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117361903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).