C16H17NO4 — CID 117463524
3-(2-cyclopentyloxy-6-methylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117463524) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-(2-cyclopentyloxy-6-methylphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(2-cyclopentyloxy-6-methylphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117463524 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-(2-cyclopentyloxy-6-methylphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | Cc1cccc(OC2CCCC2)c1-c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C16H17NO4/c1-10-5-4-8-13(20-11-6-2-3-7-11)15(10)12-9-14(16(18)19)21-17-12/h4-5,8-9,11H,2-3,6-7H2,1H3,(H,18,19) |
| InChIKey | OQORQSOAEDWHSU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |