C14H20O2S — CID 117384484
3-[2-(thian-3-yloxy)phenyl]propan-1-ol (PubChem CID 117384484) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-[2-(thian-3-yloxy)phenyl]propan-1-ol.
| Compound Name | 3-[2-(thian-3-yloxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117384484 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-[2-(thian-3-yloxy)phenyl]propan-1-ol |
| SMILES | OCCCc1ccccc1OC1CCCSC1 |
| InChI | InChI=1S/C14H20O2S/c15-9-3-6-12-5-1-2-8-14(12)16-13-7-4-10-17-11-13/h1-2,5,8,13,15H,3-4,6-7,9-11H2 |
| InChIKey | BIIDPHMJIGNYKC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |